5-methoxypyrimidine-4-carboxylic acid

C6H6N2O3 — CID 82651721

IUPAC5-methoxypyrimidine-4-carboxylic acid
SMILESCOc1cncnc1C(=O)O
InChIInChI=1S/C6H6N2O3/c1-11-4-2-7-3-8-5(4)6(9)10/h2-3H,1H3,(H,9,10)
InChIKeyXTANBKOPBFRKFQ-UHFFFAOYSA-N
MW154.12 g/mol
LogP0.18
Rot. Bonds2

About 5-methoxypyrimidine-4-carboxylic acid

5-methoxypyrimidine-4-carboxylic acid (PubChem CID 82651721) has the molecular formula C6H6N2O3 and a molecular weight of 154.12 g/mol. Its IUPAC name is 5-methoxypyrimidine-4-carboxylic acid.

Molecular Properties

Compound Name5-methoxypyrimidine-4-carboxylic acid
PubChem CID82651721
Molecular FormulaC6H6N2O3
Molecular Weight154.12 g/mol
Exact Mass154.04
IUPAC Name5-methoxypyrimidine-4-carboxylic acid
SMILESCOc1cncnc1C(=O)O
InChIInChI=1S/C6H6N2O3/c1-11-4-2-7-3-8-5(4)6(9)10/h2-3H,1H3,(H,9,10)
InChIKeyXTANBKOPBFRKFQ-UHFFFAOYSA-N
XLogP0.18
TPSA72.31 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.12
LogP ≤ 50.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-methoxypyrimidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methoxypyrimidine-4-carboxylic acid?
The IUPAC name of 5-methoxypyrimidine-4-carboxylic acid (CID 82651721) is 5-methoxypyrimidine-4-carboxylic acid.
What is the SMILES notation for 5-methoxypyrimidine-4-carboxylic acid?
The canonical SMILES for 5-methoxypyrimidine-4-carboxylic acid is COc1cncnc1C(=O)O.
What is the InChIKey of 5-methoxypyrimidine-4-carboxylic acid?
The InChIKey is XTANBKOPBFRKFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O3/c1-11-4-2-7-3-8-5(4)6(9)10/h2-3H,1H3,(H,9,10).
What are the key properties of 5-methoxypyrimidine-4-carboxylic acid?
5-methoxypyrimidine-4-carboxylic acid has a molecular weight of 154.12 g/mol, XLogP of 0.18, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxypyrimidine-4-carboxylic acid is sourced from PubChem (CID 82651721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).