About 1-(6-methoxy-2,5-dimethylpyrimidin-4-yl)ethanone
1-(6-methoxy-2,5-dimethylpyrimidin-4-yl)ethanone (PubChem CID 82654249) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 1-(6-methoxy-2,5-dimethylpyrimidin-4-yl)ethanone.
Molecular Properties
| Compound Name | 1-(6-methoxy-2,5-dimethylpyrimidin-4-yl)ethanone |
| PubChem CID | 82654249 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 1-(6-methoxy-2,5-dimethylpyrimidin-4-yl)ethanone |
| SMILES | COc1nc(C)nc(C(C)=O)c1C |
| InChI | InChI=1S/C9H12N2O2/c1-5-8(6(2)12)10-7(3)11-9(5)13-4/h1-4H3 |
| InChIKey | CIGSSJREEPNJBQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(6-methoxy-2,5-dimethylpyrimidin-4-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-methoxy-2,5-dimethylpyrimidin-4-yl)ethanone?
The IUPAC name of 1-(6-methoxy-2,5-dimethylpyrimidin-4-yl)ethanone (CID 82654249) is 1-(6-methoxy-2,5-dimethylpyrimidin-4-yl)ethanone.
What is the SMILES notation for 1-(6-methoxy-2,5-dimethylpyrimidin-4-yl)ethanone?
The canonical SMILES for 1-(6-methoxy-2,5-dimethylpyrimidin-4-yl)ethanone is COc1nc(C)nc(C(C)=O)c1C.
What is the InChIKey of 1-(6-methoxy-2,5-dimethylpyrimidin-4-yl)ethanone?
The InChIKey is CIGSSJREEPNJBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-5-8(6(2)12)10-7(3)11-9(5)13-4/h1-4H3.
What are the key properties of 1-(6-methoxy-2,5-dimethylpyrimidin-4-yl)ethanone?
1-(6-methoxy-2,5-dimethylpyrimidin-4-yl)ethanone has a molecular weight of 180.21 g/mol, XLogP of 1.30, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-methoxy-2,5-dimethylpyrimidin-4-yl)ethanone is sourced from PubChem (CID 82654249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).