About 3-chloro-5H-pyrrolo[2,3-b]pyrazine-7-carbaldehyde
3-chloro-5H-pyrrolo[2,3-b]pyrazine-7-carbaldehyde (PubChem CID 82654716) has the molecular formula C7H4ClN3O
and a molecular weight of 181.58 g/mol. Its IUPAC name is 3-chloro-5H-pyrrolo[2,3-b]pyrazine-7-carbaldehyde.
Molecular Properties
| Compound Name | 3-chloro-5H-pyrrolo[2,3-b]pyrazine-7-carbaldehyde |
| PubChem CID | 82654716 |
| Molecular Formula | C7H4ClN3O |
| Molecular Weight | 181.58 g/mol |
| Exact Mass | 181.00 |
| IUPAC Name | 3-chloro-5H-pyrrolo[2,3-b]pyrazine-7-carbaldehyde |
| SMILES | O=Cc1c[nH]c2nc(Cl)cnc12 |
| InChI | InChI=1S/C7H4ClN3O/c8-5-2-9-6-4(3-12)1-10-7(6)11-5/h1-3H,(H,10,11) |
| InChIKey | INWHMTOANDXOJV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.58 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-5H-pyrrolo[2,3-b]pyrazine-7-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5H-pyrrolo[2,3-b]pyrazine-7-carbaldehyde?
The IUPAC name of 3-chloro-5H-pyrrolo[2,3-b]pyrazine-7-carbaldehyde (CID 82654716) is 3-chloro-5H-pyrrolo[2,3-b]pyrazine-7-carbaldehyde.
What is the SMILES notation for 3-chloro-5H-pyrrolo[2,3-b]pyrazine-7-carbaldehyde?
The canonical SMILES for 3-chloro-5H-pyrrolo[2,3-b]pyrazine-7-carbaldehyde is O=Cc1c[nH]c2nc(Cl)cnc12.
What is the InChIKey of 3-chloro-5H-pyrrolo[2,3-b]pyrazine-7-carbaldehyde?
The InChIKey is INWHMTOANDXOJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClN3O/c8-5-2-9-6-4(3-12)1-10-7(6)11-5/h1-3H,(H,10,11).
What are the key properties of 3-chloro-5H-pyrrolo[2,3-b]pyrazine-7-carbaldehyde?
3-chloro-5H-pyrrolo[2,3-b]pyrazine-7-carbaldehyde has a molecular weight of 181.58 g/mol, XLogP of 1.42, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5H-pyrrolo[2,3-b]pyrazine-7-carbaldehyde is sourced from PubChem (CID 82654716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).