C8H14N4O — CID 82654876
5-methyl-4-piperazin-1-yl-1,2-dihydropyrazol-3-one (PubChem CID 82654876) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 5-methyl-4-piperazin-1-yl-1,2-dihydropyrazol-3-one.
| Compound Name | 5-methyl-4-piperazin-1-yl-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 82654876 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 5-methyl-4-piperazin-1-yl-1,2-dihydropyrazol-3-one |
| SMILES | Cc1[nH][nH]c(=O)c1N1CCNCC1 |
| InChI | InChI=1S/C8H14N4O/c1-6-7(8(13)11-10-6)12-4-2-9-3-5-12/h9H,2-5H2,1H3,(H2,10,11,13) |
| InChIKey | JRBPGXXWIBSHHG-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 63.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |