C8H13N3O2 — CID 82655075
2-ethyl-5-[(methoxyamino)methyl]-1H-pyrimidin-6-one (PubChem CID 82655075) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-ethyl-5-[(methoxyamino)methyl]-1H-pyrimidin-6-one.
| Compound Name | 2-ethyl-5-[(methoxyamino)methyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 82655075 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 2-ethyl-5-[(methoxyamino)methyl]-1H-pyrimidin-6-one |
| SMILES | CCc1ncc(CNOC)c(=O)[nH]1 |
| InChI | InChI=1S/C8H13N3O2/c1-3-7-9-4-6(5-10-13-2)8(12)11-7/h4,10H,3,5H2,1-2H3,(H,9,11,12) |
| InChIKey | SRJCAXCLHJYYFI-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|