C10H17NO2 — CID 82655138
2,3,4,5,6,7,8,8a-octahydro-1H-quinoline-4a-carboxylic acid (PubChem CID 82655138) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 2,3,4,5,6,7,8,8a-octahydro-1H-quinoline-4a-carboxylic acid.
| Compound Name | 2,3,4,5,6,7,8,8a-octahydro-1H-quinoline-4a-carboxylic acid |
|---|---|
| PubChem CID | 82655138 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 2,3,4,5,6,7,8,8a-octahydro-1H-quinoline-4a-carboxylic acid |
| SMILES | O=C(O)C12CCCCC1NCCC2 |
| InChI | InChI=1S/C10H17NO2/c12-9(13)10-5-2-1-4-8(10)11-7-3-6-10/h8,11H,1-7H2,(H,12,13) |
| InChIKey | CXELCNCRJSTZGP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |