About 4-piperidin-2-yl-3H-1,3-thiazol-2-one
4-piperidin-2-yl-3H-1,3-thiazol-2-one (PubChem CID 82655342) has the molecular formula C8H12N2OS
and a molecular weight of 184.26 g/mol. Its IUPAC name is 4-piperidin-2-yl-3H-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4-piperidin-2-yl-3H-1,3-thiazol-2-one |
| PubChem CID | 82655342 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 4-piperidin-2-yl-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(C2CCCCN2)cs1 |
| InChI | InChI=1S/C8H12N2OS/c11-8-10-7(5-12-8)6-3-1-2-4-9-6/h5-6,9H,1-4H2,(H,10,11) |
| InChIKey | NTONJAIUAIUHNL-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-piperidin-2-yl-3H-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperidin-2-yl-3H-1,3-thiazol-2-one?
The IUPAC name of 4-piperidin-2-yl-3H-1,3-thiazol-2-one (CID 82655342) is 4-piperidin-2-yl-3H-1,3-thiazol-2-one.
What is the SMILES notation for 4-piperidin-2-yl-3H-1,3-thiazol-2-one?
The canonical SMILES for 4-piperidin-2-yl-3H-1,3-thiazol-2-one is O=c1[nH]c(C2CCCCN2)cs1.
What is the InChIKey of 4-piperidin-2-yl-3H-1,3-thiazol-2-one?
The InChIKey is NTONJAIUAIUHNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2OS/c11-8-10-7(5-12-8)6-3-1-2-4-9-6/h5-6,9H,1-4H2,(H,10,11).
What are the key properties of 4-piperidin-2-yl-3H-1,3-thiazol-2-one?
4-piperidin-2-yl-3H-1,3-thiazol-2-one has a molecular weight of 184.26 g/mol, XLogP of 1.25, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperidin-2-yl-3H-1,3-thiazol-2-one is sourced from PubChem (CID 82655342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).