C10H12N4 — CID 82655819
5-pyrrolidin-3-yl-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 82655819) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 5-pyrrolidin-3-yl-7H-pyrrolo[2,3-d]pyrimidine.
| Compound Name | 5-pyrrolidin-3-yl-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 82655819 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 5-pyrrolidin-3-yl-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | c1ncc2c(C3CCNC3)c[nH]c2n1 |
| InChI | InChI=1S/C10H12N4/c1-2-11-3-7(1)8-5-13-10-9(8)4-12-6-14-10/h4-7,11H,1-3H2,(H,12,13,14) |
| InChIKey | FAZILDHXBBPXBS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |