About 7-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1,4-diazepan-5-one
7-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1,4-diazepan-5-one (PubChem CID 82664649) has the molecular formula C13H16N4O
and a molecular weight of 244.30 g/mol. Its IUPAC name is 7-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 7-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1,4-diazepan-5-one |
| PubChem CID | 82664649 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 7-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1,4-diazepan-5-one |
| SMILES | Cn1cc(C2CC(=O)NCCN2)c2ncccc21 |
| InChI | InChI=1S/C13H16N4O/c1-17-8-9(13-11(17)3-2-4-16-13)10-7-12(18)15-6-5-14-10/h2-4,8,10,14H,5-7H2,1H3,(H,15,18) |
| InChIKey | QUXNSYGTSSNKKT-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1,4-diazepan-5-one?
The IUPAC name of 7-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1,4-diazepan-5-one (CID 82664649) is 7-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1,4-diazepan-5-one.
What is the SMILES notation for 7-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1,4-diazepan-5-one?
The canonical SMILES for 7-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1,4-diazepan-5-one is Cn1cc(C2CC(=O)NCCN2)c2ncccc21.
What is the InChIKey of 7-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1,4-diazepan-5-one?
The InChIKey is QUXNSYGTSSNKKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O/c1-17-8-9(13-11(17)3-2-4-16-13)10-7-12(18)15-6-5-14-10/h2-4,8,10,14H,5-7H2,1H3,(H,15,18).
What are the key properties of 7-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1,4-diazepan-5-one?
7-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1,4-diazepan-5-one has a molecular weight of 244.30 g/mol, XLogP of 0.72, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1,4-diazepan-5-one is sourced from PubChem (CID 82664649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).