C15H16O4 — CID 82665807
1-(6-methoxy-1-benzofuran-2-yl)cyclopentane-1-carboxylic acid (PubChem CID 82665807) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 1-(6-methoxy-1-benzofuran-2-yl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-(6-methoxy-1-benzofuran-2-yl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 82665807 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-(6-methoxy-1-benzofuran-2-yl)cyclopentane-1-carboxylic acid |
| SMILES | COc1ccc2cc(C3(C(=O)O)CCCC3)oc2c1 |
| InChI | InChI=1S/C15H16O4/c1-18-11-5-4-10-8-13(19-12(10)9-11)15(14(16)17)6-2-3-7-15/h4-5,8-9H,2-3,6-7H2,1H3,(H,16,17) |
| InChIKey | QQQFAPGMNYVTIV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |