About 2-[5-(1H-pyrazol-5-yl)-1,3,4-oxadiazol-2-yl]propan-2-amine
2-[5-(1H-pyrazol-5-yl)-1,3,4-oxadiazol-2-yl]propan-2-amine (PubChem CID 82669845) has the molecular formula C8H11N5O
and a molecular weight of 193.21 g/mol. Its IUPAC name is 2-[5-(1H-pyrazol-5-yl)-1,3,4-oxadiazol-2-yl]propan-2-amine.
Molecular Properties
| Compound Name | 2-[5-(1H-pyrazol-5-yl)-1,3,4-oxadiazol-2-yl]propan-2-amine |
| PubChem CID | 82669845 |
| Molecular Formula | C8H11N5O |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 2-[5-(1H-pyrazol-5-yl)-1,3,4-oxadiazol-2-yl]propan-2-amine |
| SMILES | CC(C)(N)c1nnc(-c2ccn[nH]2)o1 |
| InChI | InChI=1S/C8H11N5O/c1-8(2,9)7-13-12-6(14-7)5-3-4-10-11-5/h3-4H,9H2,1-2H3,(H,10,11) |
| InChIKey | TWCSSPJHXLRNCL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-(1H-pyrazol-5-yl)-1,3,4-oxadiazol-2-yl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(1H-pyrazol-5-yl)-1,3,4-oxadiazol-2-yl]propan-2-amine?
The IUPAC name of 2-[5-(1H-pyrazol-5-yl)-1,3,4-oxadiazol-2-yl]propan-2-amine (CID 82669845) is 2-[5-(1H-pyrazol-5-yl)-1,3,4-oxadiazol-2-yl]propan-2-amine.
What is the SMILES notation for 2-[5-(1H-pyrazol-5-yl)-1,3,4-oxadiazol-2-yl]propan-2-amine?
The canonical SMILES for 2-[5-(1H-pyrazol-5-yl)-1,3,4-oxadiazol-2-yl]propan-2-amine is CC(C)(N)c1nnc(-c2ccn[nH]2)o1.
What is the InChIKey of 2-[5-(1H-pyrazol-5-yl)-1,3,4-oxadiazol-2-yl]propan-2-amine?
The InChIKey is TWCSSPJHXLRNCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5O/c1-8(2,9)7-13-12-6(14-7)5-3-4-10-11-5/h3-4H,9H2,1-2H3,(H,10,11).
What are the key properties of 2-[5-(1H-pyrazol-5-yl)-1,3,4-oxadiazol-2-yl]propan-2-amine?
2-[5-(1H-pyrazol-5-yl)-1,3,4-oxadiazol-2-yl]propan-2-amine has a molecular weight of 193.21 g/mol, XLogP of 0.65, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(1H-pyrazol-5-yl)-1,3,4-oxadiazol-2-yl]propan-2-amine is sourced from PubChem (CID 82669845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).