About (2-piperidin-4-yl-1,3-thiazol-4-yl)methanamine
(2-piperidin-4-yl-1,3-thiazol-4-yl)methanamine (PubChem CID 82670559) has the molecular formula C9H15N3S
and a molecular weight of 197.31 g/mol. Its IUPAC name is (2-piperidin-4-yl-1,3-thiazol-4-yl)methanamine.
Molecular Properties
| Compound Name | (2-piperidin-4-yl-1,3-thiazol-4-yl)methanamine |
| PubChem CID | 82670559 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | (2-piperidin-4-yl-1,3-thiazol-4-yl)methanamine |
| SMILES | NCc1csc(C2CCNCC2)n1 |
| InChI | InChI=1S/C9H15N3S/c10-5-8-6-13-9(12-8)7-1-3-11-4-2-7/h6-7,11H,1-5,10H2 |
| InChIKey | PFXYFYHMYKIATR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-piperidin-4-yl-1,3-thiazol-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-piperidin-4-yl-1,3-thiazol-4-yl)methanamine?
The IUPAC name of (2-piperidin-4-yl-1,3-thiazol-4-yl)methanamine (CID 82670559) is (2-piperidin-4-yl-1,3-thiazol-4-yl)methanamine.
What is the SMILES notation for (2-piperidin-4-yl-1,3-thiazol-4-yl)methanamine?
The canonical SMILES for (2-piperidin-4-yl-1,3-thiazol-4-yl)methanamine is NCc1csc(C2CCNCC2)n1.
What is the InChIKey of (2-piperidin-4-yl-1,3-thiazol-4-yl)methanamine?
The InChIKey is PFXYFYHMYKIATR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3S/c10-5-8-6-13-9(12-8)7-1-3-11-4-2-7/h6-7,11H,1-5,10H2.
What are the key properties of (2-piperidin-4-yl-1,3-thiazol-4-yl)methanamine?
(2-piperidin-4-yl-1,3-thiazol-4-yl)methanamine has a molecular weight of 197.31 g/mol, XLogP of 1.07, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-piperidin-4-yl-1,3-thiazol-4-yl)methanamine is sourced from PubChem (CID 82670559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).