About 4-amino-2-(2,5-dioxopyrrol-1-yl)-4-oxobutanoic acid
4-amino-2-(2,5-dioxopyrrol-1-yl)-4-oxobutanoic acid (PubChem CID 82673595) has the molecular formula C8H8N2O5
and a molecular weight of 212.16 g/mol. Its IUPAC name is 4-amino-2-(2,5-dioxopyrrol-1-yl)-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-amino-2-(2,5-dioxopyrrol-1-yl)-4-oxobutanoic acid |
| PubChem CID | 82673595 |
| Molecular Formula | C8H8N2O5 |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 4-amino-2-(2,5-dioxopyrrol-1-yl)-4-oxobutanoic acid |
| SMILES | NC(=O)CC(C(=O)O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C8H8N2O5/c9-5(11)3-4(8(14)15)10-6(12)1-2-7(10)13/h1-2,4H,3H2,(H2,9,11)(H,14,15) |
| InChIKey | MANWCZMIMGNWEH-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-(2,5-dioxopyrrol-1-yl)-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-(2,5-dioxopyrrol-1-yl)-4-oxobutanoic acid?
The IUPAC name of 4-amino-2-(2,5-dioxopyrrol-1-yl)-4-oxobutanoic acid (CID 82673595) is 4-amino-2-(2,5-dioxopyrrol-1-yl)-4-oxobutanoic acid.
What is the SMILES notation for 4-amino-2-(2,5-dioxopyrrol-1-yl)-4-oxobutanoic acid?
The canonical SMILES for 4-amino-2-(2,5-dioxopyrrol-1-yl)-4-oxobutanoic acid is NC(=O)CC(C(=O)O)N1C(=O)C=CC1=O.
What is the InChIKey of 4-amino-2-(2,5-dioxopyrrol-1-yl)-4-oxobutanoic acid?
The InChIKey is MANWCZMIMGNWEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O5/c9-5(11)3-4(8(14)15)10-6(12)1-2-7(10)13/h1-2,4H,3H2,(H2,9,11)(H,14,15).
What are the key properties of 4-amino-2-(2,5-dioxopyrrol-1-yl)-4-oxobutanoic acid?
4-amino-2-(2,5-dioxopyrrol-1-yl)-4-oxobutanoic acid has a molecular weight of 212.16 g/mol, XLogP of -1.76, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-(2,5-dioxopyrrol-1-yl)-4-oxobutanoic acid is sourced from PubChem (CID 82673595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).