C12H10N2O2S2 — CID 826745
2-methylsulfanyl-5-phenylsulfanylpyrimidine-4-carboxylic acid (PubChem CID 826745) has the molecular formula C12H10N2O2S2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-methylsulfanyl-5-phenylsulfanylpyrimidine-4-carboxylic acid.
| Compound Name | 2-methylsulfanyl-5-phenylsulfanylpyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 826745 |
| Molecular Formula | C12H10N2O2S2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 2-methylsulfanyl-5-phenylsulfanylpyrimidine-4-carboxylic acid |
| SMILES | CSc1ncc(Sc2ccccc2)c(C(=O)O)n1 |
| InChI | InChI=1S/C12H10N2O2S2/c1-17-12-13-7-9(10(14-12)11(15)16)18-8-5-3-2-4-6-8/h2-7H,1H3,(H,15,16) |
| InChIKey | BGIFQPLDWJDWRQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |