C14H9Cl5O — CID 8268
2,2,2-trichloro-1,1-bis(4-chlorophenyl)ethanol (PubChem CID 8268) has the molecular formula C14H9Cl5O and a molecular weight of 370.49 g/mol. Its IUPAC name is 2,2,2-trichloro-1,1-bis(4-chlorophenyl)ethanol.
| Compound Name | 2,2,2-trichloro-1,1-bis(4-chlorophenyl)ethanol |
|---|---|
| PubChem CID | 8268 |
| Molecular Formula | C14H9Cl5O |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 367.91 |
| IUPAC Name | 2,2,2-trichloro-1,1-bis(4-chlorophenyl)ethanol |
| SMILES | OC(c1ccc(Cl)cc1)(c1ccc(Cl)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H9Cl5O/c15-11-5-1-9(2-6-11)13(20,14(17,18)19)10-3-7-12(16)8-4-10/h1-8,20H |
| InChIKey | UOAMTSKGCBMZTC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|