About 5-amino-4-methyl-N-(1,3-thiazol-2-yl)pentanamide
5-amino-4-methyl-N-(1,3-thiazol-2-yl)pentanamide (PubChem CID 82682761) has the molecular formula C9H15N3OS
and a molecular weight of 213.31 g/mol. Its IUPAC name is 5-amino-4-methyl-N-(1,3-thiazol-2-yl)pentanamide.
Molecular Properties
| Compound Name | 5-amino-4-methyl-N-(1,3-thiazol-2-yl)pentanamide |
| PubChem CID | 82682761 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 5-amino-4-methyl-N-(1,3-thiazol-2-yl)pentanamide |
| SMILES | CC(CN)CCC(=O)Nc1nccs1 |
| InChI | InChI=1S/C9H15N3OS/c1-7(6-10)2-3-8(13)12-9-11-4-5-14-9/h4-5,7H,2-3,6,10H2,1H3,(H,11,12,13) |
| InChIKey | TUXIKIZSFIQHJG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-4-methyl-N-(1,3-thiazol-2-yl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-methyl-N-(1,3-thiazol-2-yl)pentanamide?
The IUPAC name of 5-amino-4-methyl-N-(1,3-thiazol-2-yl)pentanamide (CID 82682761) is 5-amino-4-methyl-N-(1,3-thiazol-2-yl)pentanamide.
What is the SMILES notation for 5-amino-4-methyl-N-(1,3-thiazol-2-yl)pentanamide?
The canonical SMILES for 5-amino-4-methyl-N-(1,3-thiazol-2-yl)pentanamide is CC(CN)CCC(=O)Nc1nccs1.
What is the InChIKey of 5-amino-4-methyl-N-(1,3-thiazol-2-yl)pentanamide?
The InChIKey is TUXIKIZSFIQHJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3OS/c1-7(6-10)2-3-8(13)12-9-11-4-5-14-9/h4-5,7H,2-3,6,10H2,1H3,(H,11,12,13).
What are the key properties of 5-amino-4-methyl-N-(1,3-thiazol-2-yl)pentanamide?
5-amino-4-methyl-N-(1,3-thiazol-2-yl)pentanamide has a molecular weight of 213.31 g/mol, XLogP of 1.46, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-methyl-N-(1,3-thiazol-2-yl)pentanamide is sourced from PubChem (CID 82682761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).