About N',2-dimethyl-N'-(2-methylsulfonylethyl)pentane-1,5-diamine
N',2-dimethyl-N'-(2-methylsulfonylethyl)pentane-1,5-diamine (PubChem CID 82683161) has the molecular formula C10H24N2O2S
and a molecular weight of 236.38 g/mol. Its IUPAC name is N',2-dimethyl-N'-(2-methylsulfonylethyl)pentane-1,5-diamine.
Molecular Properties
| Compound Name | N',2-dimethyl-N'-(2-methylsulfonylethyl)pentane-1,5-diamine |
| PubChem CID | 82683161 |
| Molecular Formula | C10H24N2O2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | N',2-dimethyl-N'-(2-methylsulfonylethyl)pentane-1,5-diamine |
| SMILES | CC(CN)CCCN(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C10H24N2O2S/c1-10(9-11)5-4-6-12(2)7-8-15(3,13)14/h10H,4-9,11H2,1-3H3 |
| InChIKey | QUPQFHXZLYLTPZ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N',2-dimethyl-N'-(2-methylsulfonylethyl)pentane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',2-dimethyl-N'-(2-methylsulfonylethyl)pentane-1,5-diamine?
The IUPAC name of N',2-dimethyl-N'-(2-methylsulfonylethyl)pentane-1,5-diamine (CID 82683161) is N',2-dimethyl-N'-(2-methylsulfonylethyl)pentane-1,5-diamine.
What is the SMILES notation for N',2-dimethyl-N'-(2-methylsulfonylethyl)pentane-1,5-diamine?
The canonical SMILES for N',2-dimethyl-N'-(2-methylsulfonylethyl)pentane-1,5-diamine is CC(CN)CCCN(C)CCS(C)(=O)=O.
What is the InChIKey of N',2-dimethyl-N'-(2-methylsulfonylethyl)pentane-1,5-diamine?
The InChIKey is QUPQFHXZLYLTPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2O2S/c1-10(9-11)5-4-6-12(2)7-8-15(3,13)14/h10H,4-9,11H2,1-3H3.
What are the key properties of N',2-dimethyl-N'-(2-methylsulfonylethyl)pentane-1,5-diamine?
N',2-dimethyl-N'-(2-methylsulfonylethyl)pentane-1,5-diamine has a molecular weight of 236.38 g/mol, XLogP of 0.34, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N',2-dimethyl-N'-(2-methylsulfonylethyl)pentane-1,5-diamine is sourced from PubChem (CID 82683161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).