C15H16FN5 — CID 82683222
5-fluoro-2-[[5-methyl-2-(propylamino)pyrimidin-4-yl]amino]benzonitrile (PubChem CID 82683222) has the molecular formula C15H16FN5 and a molecular weight of 285.33 g/mol. Its IUPAC name is 5-fluoro-2-[[5-methyl-2-(propylamino)pyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 5-fluoro-2-[[5-methyl-2-(propylamino)pyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 82683222 |
| Molecular Formula | C15H16FN5 |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 5-fluoro-2-[[5-methyl-2-(propylamino)pyrimidin-4-yl]amino]benzonitrile |
| SMILES | CCCNc1ncc(C)c(Nc2ccc(F)cc2C#N)n1 |
| InChI | InChI=1S/C15H16FN5/c1-3-6-18-15-19-9-10(2)14(21-15)20-13-5-4-12(16)7-11(13)8-17/h4-5,7,9H,3,6H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | QYVDVTYJUGCGSP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |