C15H15BrFNOS — CID 82686874
2-bromo-N-(3-fluoro-4-methoxyphenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82686874) has the molecular formula C15H15BrFNOS and a molecular weight of 356.26 g/mol. Its IUPAC name is 2-bromo-N-(3-fluoro-4-methoxyphenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | 2-bromo-N-(3-fluoro-4-methoxyphenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82686874 |
| Molecular Formula | C15H15BrFNOS |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 2-bromo-N-(3-fluoro-4-methoxyphenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | COc1ccc(NC2CCCc3sc(Br)cc32)cc1F |
| InChI | InChI=1S/C15H15BrFNOS/c1-19-13-6-5-9(7-11(13)17)18-12-3-2-4-14-10(12)8-15(16)20-14/h5-8,12,18H,2-4H2,1H3 |
| InChIKey | DLCUMLCVMWUCLB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|