C16H17FINS — CID 82686952
N-[1-(3-fluorophenyl)ethyl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82686952) has the molecular formula C16H17FINS and a molecular weight of 401.29 g/mol. Its IUPAC name is N-[1-(3-fluorophenyl)ethyl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | N-[1-(3-fluorophenyl)ethyl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82686952 |
| Molecular Formula | C16H17FINS |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | N-[1-(3-fluorophenyl)ethyl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | CC(NC1CCCc2sc(I)cc21)c1cccc(F)c1 |
| InChI | InChI=1S/C16H17FINS/c1-10(11-4-2-5-12(17)8-11)19-14-6-3-7-15-13(14)9-16(18)20-15/h2,4-5,8-10,14,19H,3,6-7H2,1H3 |
| InChIKey | WQDJACKNEZYKPU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|