C14H23IN2S — CID 82687027
N',N'-diethyl-N-(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)ethane-1,2-diamine (PubChem CID 82687027) has the molecular formula C14H23IN2S and a molecular weight of 378.32 g/mol. Its IUPAC name is N',N'-diethyl-N-(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 82687027 |
| Molecular Formula | C14H23IN2S |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | N',N'-diethyl-N-(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)ethane-1,2-diamine |
| SMILES | CCN(CC)CCNC1CCCc2sc(I)cc21 |
| InChI | InChI=1S/C14H23IN2S/c1-3-17(4-2)9-8-16-12-6-5-7-13-11(12)10-14(15)18-13/h10,12,16H,3-9H2,1-2H3 |
| InChIKey | CURWBTXRYTVYLK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|