C14H23ClN2S — CID 82687038
1-N-(2-chloro-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-2-N,2-N,2-trimethylpropane-1,2-diamine (PubChem CID 82687038) has the molecular formula C14H23ClN2S and a molecular weight of 286.87 g/mol. Its IUPAC name is 1-N-(2-chloro-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-2-N,2-N,2-trimethylpropane-1,2-diamine.
| Compound Name | 1-N-(2-chloro-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-2-N,2-N,2-trimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 82687038 |
| Molecular Formula | C14H23ClN2S |
| Molecular Weight | 286.87 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 1-N-(2-chloro-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-2-N,2-N,2-trimethylpropane-1,2-diamine |
| SMILES | CN(C)C(C)(C)CNC1CCCc2sc(Cl)cc21 |
| InChI | InChI=1S/C14H23ClN2S/c1-14(2,17(3)4)9-16-11-6-5-7-12-10(11)8-13(15)18-12/h8,11,16H,5-7,9H2,1-4H3 |
| InChIKey | OTLUCLWYQOEUJX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.87 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |