C16H24INS — CID 82690346
N-(4,4-dimethylcyclohexyl)-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82690346) has the molecular formula C16H24INS and a molecular weight of 389.35 g/mol. Its IUPAC name is N-(4,4-dimethylcyclohexyl)-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | N-(4,4-dimethylcyclohexyl)-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82690346 |
| Molecular Formula | C16H24INS |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | N-(4,4-dimethylcyclohexyl)-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | CC1(C)CCC(NC2CCCc3sc(I)cc32)CC1 |
| InChI | InChI=1S/C16H24INS/c1-16(2)8-6-11(7-9-16)18-13-4-3-5-14-12(13)10-15(17)19-14/h10-11,13,18H,3-9H2,1-2H3 |
| InChIKey | JXTKRTVXWVVCMN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|