C12H15BrF3NOS — CID 82690566
2-bromo-N-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82690566) has the molecular formula C12H15BrF3NOS and a molecular weight of 358.22 g/mol. Its IUPAC name is 2-bromo-N-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | 2-bromo-N-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82690566 |
| Molecular Formula | C12H15BrF3NOS |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 2-bromo-N-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | FC(F)(F)COCCNC1CCCc2sc(Br)cc21 |
| InChI | InChI=1S/C12H15BrF3NOS/c13-11-6-8-9(2-1-3-10(8)19-11)17-4-5-18-7-12(14,15)16/h6,9,17H,1-5,7H2 |
| InChIKey | RYAACSIFIUPSBD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|