About 5,6-dichloro-N,N-diethylpyridine-3-sulfonamide
5,6-dichloro-N,N-diethylpyridine-3-sulfonamide (PubChem CID 826913) has the molecular formula C9H12Cl2N2O2S
and a molecular weight of 283.18 g/mol. Its IUPAC name is 5,6-dichloro-N,N-diethylpyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 5,6-dichloro-N,N-diethylpyridine-3-sulfonamide |
| PubChem CID | 826913 |
| Molecular Formula | C9H12Cl2N2O2S |
| Molecular Weight | 283.18 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 5,6-dichloro-N,N-diethylpyridine-3-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H12Cl2N2O2S/c1-3-13(4-2)16(14,15)7-5-8(10)9(11)12-6-7/h5-6H,3-4H2,1-2H3 |
| InChIKey | QXAROKGROHDUFF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.18 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dichloro-N,N-diethylpyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichloro-N,N-diethylpyridine-3-sulfonamide?
The IUPAC name of 5,6-dichloro-N,N-diethylpyridine-3-sulfonamide (CID 826913) is 5,6-dichloro-N,N-diethylpyridine-3-sulfonamide.
What is the SMILES notation for 5,6-dichloro-N,N-diethylpyridine-3-sulfonamide?
The canonical SMILES for 5,6-dichloro-N,N-diethylpyridine-3-sulfonamide is CCN(CC)S(=O)(=O)c1cnc(Cl)c(Cl)c1.
What is the InChIKey of 5,6-dichloro-N,N-diethylpyridine-3-sulfonamide?
The InChIKey is QXAROKGROHDUFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12Cl2N2O2S/c1-3-13(4-2)16(14,15)7-5-8(10)9(11)12-6-7/h5-6H,3-4H2,1-2H3.
What are the key properties of 5,6-dichloro-N,N-diethylpyridine-3-sulfonamide?
5,6-dichloro-N,N-diethylpyridine-3-sulfonamide has a molecular weight of 283.18 g/mol, XLogP of 2.42, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichloro-N,N-diethylpyridine-3-sulfonamide is sourced from PubChem (CID 826913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).