About 2-(3,5-diethylpyrazol-1-yl)-5-methylsulfonylaniline
2-(3,5-diethylpyrazol-1-yl)-5-methylsulfonylaniline (PubChem CID 82692536) has the molecular formula C14H19N3O2S
and a molecular weight of 293.39 g/mol. Its IUPAC name is 2-(3,5-diethylpyrazol-1-yl)-5-methylsulfonylaniline.
Molecular Properties
| Compound Name | 2-(3,5-diethylpyrazol-1-yl)-5-methylsulfonylaniline |
| PubChem CID | 82692536 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-(3,5-diethylpyrazol-1-yl)-5-methylsulfonylaniline |
| SMILES | CCc1cc(CC)n(-c2ccc(S(C)(=O)=O)cc2N)n1 |
| InChI | InChI=1S/C14H19N3O2S/c1-4-10-8-11(5-2)17(16-10)14-7-6-12(9-13(14)15)20(3,18)19/h6-9H,4-5,15H2,1-3H3 |
| InChIKey | HDHSYCONGAZWNM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-diethylpyrazol-1-yl)-5-methylsulfonylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-diethylpyrazol-1-yl)-5-methylsulfonylaniline?
The IUPAC name of 2-(3,5-diethylpyrazol-1-yl)-5-methylsulfonylaniline (CID 82692536) is 2-(3,5-diethylpyrazol-1-yl)-5-methylsulfonylaniline.
What is the SMILES notation for 2-(3,5-diethylpyrazol-1-yl)-5-methylsulfonylaniline?
The canonical SMILES for 2-(3,5-diethylpyrazol-1-yl)-5-methylsulfonylaniline is CCc1cc(CC)n(-c2ccc(S(C)(=O)=O)cc2N)n1.
What is the InChIKey of 2-(3,5-diethylpyrazol-1-yl)-5-methylsulfonylaniline?
The InChIKey is HDHSYCONGAZWNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O2S/c1-4-10-8-11(5-2)17(16-10)14-7-6-12(9-13(14)15)20(3,18)19/h6-9H,4-5,15H2,1-3H3.
What are the key properties of 2-(3,5-diethylpyrazol-1-yl)-5-methylsulfonylaniline?
2-(3,5-diethylpyrazol-1-yl)-5-methylsulfonylaniline has a molecular weight of 293.39 g/mol, XLogP of 1.98, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-diethylpyrazol-1-yl)-5-methylsulfonylaniline is sourced from PubChem (CID 82692536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).