C15H27N3 — CID 82692586
2-(3,5-diethylpyrazol-1-yl)-4-ethylcyclohexan-1-amine (PubChem CID 82692586) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 2-(3,5-diethylpyrazol-1-yl)-4-ethylcyclohexan-1-amine.
| Compound Name | 2-(3,5-diethylpyrazol-1-yl)-4-ethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 82692586 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 2-(3,5-diethylpyrazol-1-yl)-4-ethylcyclohexan-1-amine |
| SMILES | CCc1cc(CC)n(C2CC(CC)CCC2N)n1 |
| InChI | InChI=1S/C15H27N3/c1-4-11-7-8-14(16)15(9-11)18-13(6-3)10-12(5-2)17-18/h10-11,14-15H,4-9,16H2,1-3H3 |
| InChIKey | PULVVOAQHZTMHP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |