C13H15N5O — CID 82692657
4-(3,5-diethylpyrazol-1-yl)-2,1,3-benzoxadiazol-7-amine (PubChem CID 82692657) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is 4-(3,5-diethylpyrazol-1-yl)-2,1,3-benzoxadiazol-7-amine.
| Compound Name | 4-(3,5-diethylpyrazol-1-yl)-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 82692657 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 4-(3,5-diethylpyrazol-1-yl)-2,1,3-benzoxadiazol-7-amine |
| SMILES | CCc1cc(CC)n(-c2ccc(N)c3nonc23)n1 |
| InChI | InChI=1S/C13H15N5O/c1-3-8-7-9(4-2)18(15-8)11-6-5-10(14)12-13(11)17-19-16-12/h5-7H,3-4,14H2,1-2H3 |
| InChIKey | GHTPSECNDYTTBO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|