About 5-(3,5-diethylpyrazol-1-yl)-2,2-dimethylpentanenitrile
5-(3,5-diethylpyrazol-1-yl)-2,2-dimethylpentanenitrile (PubChem CID 82692715) has the molecular formula C14H23N3
and a molecular weight of 233.36 g/mol. Its IUPAC name is 5-(3,5-diethylpyrazol-1-yl)-2,2-dimethylpentanenitrile.
Molecular Properties
| Compound Name | 5-(3,5-diethylpyrazol-1-yl)-2,2-dimethylpentanenitrile |
| PubChem CID | 82692715 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 5-(3,5-diethylpyrazol-1-yl)-2,2-dimethylpentanenitrile |
| SMILES | CCc1cc(CC)n(CCCC(C)(C)C#N)n1 |
| InChI | InChI=1S/C14H23N3/c1-5-12-10-13(6-2)17(16-12)9-7-8-14(3,4)11-15/h10H,5-9H2,1-4H3 |
| InChIKey | ZHDSMFMZGBNXPX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3,5-diethylpyrazol-1-yl)-2,2-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-diethylpyrazol-1-yl)-2,2-dimethylpentanenitrile?
The IUPAC name of 5-(3,5-diethylpyrazol-1-yl)-2,2-dimethylpentanenitrile (CID 82692715) is 5-(3,5-diethylpyrazol-1-yl)-2,2-dimethylpentanenitrile.
What is the SMILES notation for 5-(3,5-diethylpyrazol-1-yl)-2,2-dimethylpentanenitrile?
The canonical SMILES for 5-(3,5-diethylpyrazol-1-yl)-2,2-dimethylpentanenitrile is CCc1cc(CC)n(CCCC(C)(C)C#N)n1.
What is the InChIKey of 5-(3,5-diethylpyrazol-1-yl)-2,2-dimethylpentanenitrile?
The InChIKey is ZHDSMFMZGBNXPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3/c1-5-12-10-13(6-2)17(16-12)9-7-8-14(3,4)11-15/h10H,5-9H2,1-4H3.
What are the key properties of 5-(3,5-diethylpyrazol-1-yl)-2,2-dimethylpentanenitrile?
5-(3,5-diethylpyrazol-1-yl)-2,2-dimethylpentanenitrile has a molecular weight of 233.36 g/mol, XLogP of 3.34, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-diethylpyrazol-1-yl)-2,2-dimethylpentanenitrile is sourced from PubChem (CID 82692715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).