C14H16BrN3O2 — CID 82693026
1-[(4-bromo-3-nitrophenyl)methyl]-3,5-diethylpyrazole (PubChem CID 82693026) has the molecular formula C14H16BrN3O2 and a molecular weight of 338.21 g/mol. Its IUPAC name is 1-[(4-bromo-3-nitrophenyl)methyl]-3,5-diethylpyrazole.
| Compound Name | 1-[(4-bromo-3-nitrophenyl)methyl]-3,5-diethylpyrazole |
|---|---|
| PubChem CID | 82693026 |
| Molecular Formula | C14H16BrN3O2 |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 1-[(4-bromo-3-nitrophenyl)methyl]-3,5-diethylpyrazole |
| SMILES | CCc1cc(CC)n(Cc2ccc(Br)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C14H16BrN3O2/c1-3-11-8-12(4-2)17(16-11)9-10-5-6-13(15)14(7-10)18(19)20/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | SXHDVWOZLWJHNO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|