C17H24BrN3 — CID 82693504
5-bromo-2-[1-(1-propylpiperidin-4-yl)ethylamino]benzonitrile (PubChem CID 82693504) has the molecular formula C17H24BrN3 and a molecular weight of 350.30 g/mol. Its IUPAC name is 5-bromo-2-[1-(1-propylpiperidin-4-yl)ethylamino]benzonitrile.
| Compound Name | 5-bromo-2-[1-(1-propylpiperidin-4-yl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 82693504 |
| Molecular Formula | C17H24BrN3 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 5-bromo-2-[1-(1-propylpiperidin-4-yl)ethylamino]benzonitrile |
| SMILES | CCCN1CCC(C(C)Nc2ccc(Br)cc2C#N)CC1 |
| InChI | InChI=1S/C17H24BrN3/c1-3-8-21-9-6-14(7-10-21)13(2)20-17-5-4-16(18)11-15(17)12-19/h4-5,11,13-14,20H,3,6-10H2,1-2H3 |
| InChIKey | ABWHYGAEVAWICO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |