About 2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethanamine
2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethanamine (PubChem CID 82693638) has the molecular formula C13H28N2O
and a molecular weight of 228.38 g/mol. Its IUPAC name is 2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethanamine.
Molecular Properties
| Compound Name | 2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethanamine |
| PubChem CID | 82693638 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | 2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethanamine |
| SMILES | CC(C)(C)CCN1CCC(OCCN)CC1 |
| InChI | InChI=1S/C13H28N2O/c1-13(2,3)6-10-15-8-4-12(5-9-15)16-11-7-14/h12H,4-11,14H2,1-3H3 |
| InChIKey | FKUUCAOZLRXHPP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethanamine?
The IUPAC name of 2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethanamine (CID 82693638) is 2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethanamine.
What is the SMILES notation for 2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethanamine?
The canonical SMILES for 2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethanamine is CC(C)(C)CCN1CCC(OCCN)CC1.
What is the InChIKey of 2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethanamine?
The InChIKey is FKUUCAOZLRXHPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O/c1-13(2,3)6-10-15-8-4-12(5-9-15)16-11-7-14/h12H,4-11,14H2,1-3H3.
What are the key properties of 2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethanamine?
2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethanamine has a molecular weight of 228.38 g/mol, XLogP of 1.86, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethanamine is sourced from PubChem (CID 82693638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).