About 5-bromo-2-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]benzonitrile
5-bromo-2-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]benzonitrile (PubChem CID 82693849) has the molecular formula C15H16BrClN4
and a molecular weight of 367.68 g/mol. Its IUPAC name is 5-bromo-2-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]benzonitrile.
Molecular Properties
| Compound Name | 5-bromo-2-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]benzonitrile |
| PubChem CID | 82693849 |
| Molecular Formula | C15H16BrClN4 |
| Molecular Weight | 367.68 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 5-bromo-2-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]benzonitrile |
| SMILES | CCc1nn(CC)c(CNc2ccc(Br)cc2C#N)c1Cl |
| InChI | InChI=1S/C15H16BrClN4/c1-3-12-15(17)14(21(4-2)20-12)9-19-13-6-5-11(16)7-10(13)8-18/h5-7,19H,3-4,9H2,1-2H3 |
| InChIKey | OSFOSNWXMNDOKV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.68 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-2-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]benzonitrile?
The IUPAC name of 5-bromo-2-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]benzonitrile (CID 82693849) is 5-bromo-2-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]benzonitrile.
What is the SMILES notation for 5-bromo-2-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]benzonitrile?
The canonical SMILES for 5-bromo-2-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]benzonitrile is CCc1nn(CC)c(CNc2ccc(Br)cc2C#N)c1Cl.
What is the InChIKey of 5-bromo-2-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]benzonitrile?
The InChIKey is OSFOSNWXMNDOKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16BrClN4/c1-3-12-15(17)14(21(4-2)20-12)9-19-13-6-5-11(16)7-10(13)8-18/h5-7,19H,3-4,9H2,1-2H3.
What are the key properties of 5-bromo-2-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]benzonitrile?
5-bromo-2-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]benzonitrile has a molecular weight of 367.68 g/mol, XLogP of 4.37, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]benzonitrile is sourced from PubChem (CID 82693849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).