About 3-[2-[(3,5-diethylpyrazol-1-yl)methyl]phenyl]prop-2-yn-1-ol
3-[2-[(3,5-diethylpyrazol-1-yl)methyl]phenyl]prop-2-yn-1-ol (PubChem CID 82694487) has the molecular formula C17H20N2O
and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-[2-[(3,5-diethylpyrazol-1-yl)methyl]phenyl]prop-2-yn-1-ol.
Molecular Properties
| Compound Name | 3-[2-[(3,5-diethylpyrazol-1-yl)methyl]phenyl]prop-2-yn-1-ol |
| PubChem CID | 82694487 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 3-[2-[(3,5-diethylpyrazol-1-yl)methyl]phenyl]prop-2-yn-1-ol |
| SMILES | CCc1cc(CC)n(Cc2ccccc2C#CCO)n1 |
| InChI | InChI=1S/C17H20N2O/c1-3-16-12-17(4-2)19(18-16)13-15-9-6-5-8-14(15)10-7-11-20/h5-6,8-9,12,20H,3-4,11,13H2,1-2H3 |
| InChIKey | XRTXJQOJYDGTPP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[(3,5-diethylpyrazol-1-yl)methyl]phenyl]prop-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(3,5-diethylpyrazol-1-yl)methyl]phenyl]prop-2-yn-1-ol?
The IUPAC name of 3-[2-[(3,5-diethylpyrazol-1-yl)methyl]phenyl]prop-2-yn-1-ol (CID 82694487) is 3-[2-[(3,5-diethylpyrazol-1-yl)methyl]phenyl]prop-2-yn-1-ol.
What is the SMILES notation for 3-[2-[(3,5-diethylpyrazol-1-yl)methyl]phenyl]prop-2-yn-1-ol?
The canonical SMILES for 3-[2-[(3,5-diethylpyrazol-1-yl)methyl]phenyl]prop-2-yn-1-ol is CCc1cc(CC)n(Cc2ccccc2C#CCO)n1.
What is the InChIKey of 3-[2-[(3,5-diethylpyrazol-1-yl)methyl]phenyl]prop-2-yn-1-ol?
The InChIKey is XRTXJQOJYDGTPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O/c1-3-16-12-17(4-2)19(18-16)13-15-9-6-5-8-14(15)10-7-11-20/h5-6,8-9,12,20H,3-4,11,13H2,1-2H3.
What are the key properties of 3-[2-[(3,5-diethylpyrazol-1-yl)methyl]phenyl]prop-2-yn-1-ol?
3-[2-[(3,5-diethylpyrazol-1-yl)methyl]phenyl]prop-2-yn-1-ol has a molecular weight of 268.36 g/mol, XLogP of 2.40, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(3,5-diethylpyrazol-1-yl)methyl]phenyl]prop-2-yn-1-ol is sourced from PubChem (CID 82694487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).