C15H19BrN2O — CID 82695018
1-[(3-bromo-4-methoxyphenyl)methyl]-3,5-diethylpyrazole (PubChem CID 82695018) has the molecular formula C15H19BrN2O and a molecular weight of 323.23 g/mol. Its IUPAC name is 1-[(3-bromo-4-methoxyphenyl)methyl]-3,5-diethylpyrazole.
| Compound Name | 1-[(3-bromo-4-methoxyphenyl)methyl]-3,5-diethylpyrazole |
|---|---|
| PubChem CID | 82695018 |
| Molecular Formula | C15H19BrN2O |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 1-[(3-bromo-4-methoxyphenyl)methyl]-3,5-diethylpyrazole |
| SMILES | CCc1cc(CC)n(Cc2ccc(OC)c(Br)c2)n1 |
| InChI | InChI=1S/C15H19BrN2O/c1-4-12-9-13(5-2)18(17-12)10-11-6-7-15(19-3)14(16)8-11/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | XMTDWEVBOVMEMR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |