C14H22N2O3 — CID 82695487
1-[4-(2-hydroxyethoxy)piperidine-1-carbonyl]-3-methylcyclobutane-1-carbonitrile (PubChem CID 82695487) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-[4-(2-hydroxyethoxy)piperidine-1-carbonyl]-3-methylcyclobutane-1-carbonitrile.
| Compound Name | 1-[4-(2-hydroxyethoxy)piperidine-1-carbonyl]-3-methylcyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 82695487 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 1-[4-(2-hydroxyethoxy)piperidine-1-carbonyl]-3-methylcyclobutane-1-carbonitrile |
| SMILES | CC1CC(C#N)(C(=O)N2CCC(OCCO)CC2)C1 |
| InChI | InChI=1S/C14H22N2O3/c1-11-8-14(9-11,10-15)13(18)16-4-2-12(3-5-16)19-7-6-17/h11-12,17H,2-9H2,1H3 |
| InChIKey | RWTXCNCNZVAGOL-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |