C15H16ClNOS — CID 82695773
4-[(2-chloro-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]-2-methylphenol (PubChem CID 82695773) has the molecular formula C15H16ClNOS and a molecular weight of 293.82 g/mol. Its IUPAC name is 4-[(2-chloro-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]-2-methylphenol.
| Compound Name | 4-[(2-chloro-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]-2-methylphenol |
|---|---|
| PubChem CID | 82695773 |
| Molecular Formula | C15H16ClNOS |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 4-[(2-chloro-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]-2-methylphenol |
| SMILES | Cc1cc(NC2CCCc3sc(Cl)cc32)ccc1O |
| InChI | InChI=1S/C15H16ClNOS/c1-9-7-10(5-6-13(9)18)17-12-3-2-4-14-11(12)8-15(16)19-14/h5-8,12,17-18H,2-4H2,1H3 |
| InChIKey | LTSAIOOQMAJYIQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|