About 7-amino-6-(3,5-diethylpyrazol-1-yl)-3,4-dihydro-1H-quinolin-2-one
7-amino-6-(3,5-diethylpyrazol-1-yl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 82696351) has the molecular formula C16H20N4O
and a molecular weight of 284.36 g/mol. Its IUPAC name is 7-amino-6-(3,5-diethylpyrazol-1-yl)-3,4-dihydro-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 7-amino-6-(3,5-diethylpyrazol-1-yl)-3,4-dihydro-1H-quinolin-2-one |
| PubChem CID | 82696351 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 7-amino-6-(3,5-diethylpyrazol-1-yl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCc1cc(CC)n(-c2cc3c(cc2N)NC(=O)CC3)n1 |
| InChI | InChI=1S/C16H20N4O/c1-3-11-8-12(4-2)20(19-11)15-7-10-5-6-16(21)18-14(10)9-13(15)17/h7-9H,3-6,17H2,1-2H3,(H,18,21) |
| InChIKey | NLAPHMSOMGGTHQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-6-(3,5-diethylpyrazol-1-yl)-3,4-dihydro-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-6-(3,5-diethylpyrazol-1-yl)-3,4-dihydro-1H-quinolin-2-one?
The IUPAC name of 7-amino-6-(3,5-diethylpyrazol-1-yl)-3,4-dihydro-1H-quinolin-2-one (CID 82696351) is 7-amino-6-(3,5-diethylpyrazol-1-yl)-3,4-dihydro-1H-quinolin-2-one.
What is the SMILES notation for 7-amino-6-(3,5-diethylpyrazol-1-yl)-3,4-dihydro-1H-quinolin-2-one?
The canonical SMILES for 7-amino-6-(3,5-diethylpyrazol-1-yl)-3,4-dihydro-1H-quinolin-2-one is CCc1cc(CC)n(-c2cc3c(cc2N)NC(=O)CC3)n1.
What is the InChIKey of 7-amino-6-(3,5-diethylpyrazol-1-yl)-3,4-dihydro-1H-quinolin-2-one?
The InChIKey is NLAPHMSOMGGTHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4O/c1-3-11-8-12(4-2)20(19-11)15-7-10-5-6-16(21)18-14(10)9-13(15)17/h7-9H,3-6,17H2,1-2H3,(H,18,21).
What are the key properties of 7-amino-6-(3,5-diethylpyrazol-1-yl)-3,4-dihydro-1H-quinolin-2-one?
7-amino-6-(3,5-diethylpyrazol-1-yl)-3,4-dihydro-1H-quinolin-2-one has a molecular weight of 284.36 g/mol, XLogP of 2.46, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-6-(3,5-diethylpyrazol-1-yl)-3,4-dihydro-1H-quinolin-2-one is sourced from PubChem (CID 82696351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).