C15H22INS — CID 82696534
N-[(1S)-1-cyclopentylethyl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82696534) has the molecular formula C15H22INS and a molecular weight of 375.32 g/mol. Its IUPAC name is N-[(1S)-1-cyclopentylethyl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | N-[(1S)-1-cyclopentylethyl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82696534 |
| Molecular Formula | C15H22INS |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | N-[(1S)-1-cyclopentylethyl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | C[C@H](NC1CCCc2sc(I)cc21)C1CCCC1 |
| InChI | InChI=1S/C15H22INS/c1-10(11-5-2-3-6-11)17-13-7-4-8-14-12(13)9-15(16)18-14/h9-11,13,17H,2-8H2,1H3/t10-,13?/m0/s1 |
| InChIKey | BNKALFUUMLGOID-NKUHCKNESA-N |
| XLogP | 4.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|