About [2-(3,5-diethylpyrazol-1-yl)-5-(trifluoromethyl)phenyl]methanamine
[2-(3,5-diethylpyrazol-1-yl)-5-(trifluoromethyl)phenyl]methanamine (PubChem CID 82696807) has the molecular formula C15H18F3N3
and a molecular weight of 297.32 g/mol. Its IUPAC name is [2-(3,5-diethylpyrazol-1-yl)-5-(trifluoromethyl)phenyl]methanamine.
Molecular Properties
| Compound Name | [2-(3,5-diethylpyrazol-1-yl)-5-(trifluoromethyl)phenyl]methanamine |
| PubChem CID | 82696807 |
| Molecular Formula | C15H18F3N3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | [2-(3,5-diethylpyrazol-1-yl)-5-(trifluoromethyl)phenyl]methanamine |
| SMILES | CCc1cc(CC)n(-c2ccc(C(F)(F)F)cc2CN)n1 |
| InChI | InChI=1S/C15H18F3N3/c1-3-12-8-13(4-2)21(20-12)14-6-5-11(15(16,17)18)7-10(14)9-19/h5-8H,3-4,9,19H2,1-2H3 |
| InChIKey | QGRSTKDYJVSDPN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(3,5-diethylpyrazol-1-yl)-5-(trifluoromethyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,5-diethylpyrazol-1-yl)-5-(trifluoromethyl)phenyl]methanamine?
The IUPAC name of [2-(3,5-diethylpyrazol-1-yl)-5-(trifluoromethyl)phenyl]methanamine (CID 82696807) is [2-(3,5-diethylpyrazol-1-yl)-5-(trifluoromethyl)phenyl]methanamine.
What is the SMILES notation for [2-(3,5-diethylpyrazol-1-yl)-5-(trifluoromethyl)phenyl]methanamine?
The canonical SMILES for [2-(3,5-diethylpyrazol-1-yl)-5-(trifluoromethyl)phenyl]methanamine is CCc1cc(CC)n(-c2ccc(C(F)(F)F)cc2CN)n1.
What is the InChIKey of [2-(3,5-diethylpyrazol-1-yl)-5-(trifluoromethyl)phenyl]methanamine?
The InChIKey is QGRSTKDYJVSDPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F3N3/c1-3-12-8-13(4-2)21(20-12)14-6-5-11(15(16,17)18)7-10(14)9-19/h5-8H,3-4,9,19H2,1-2H3.
What are the key properties of [2-(3,5-diethylpyrazol-1-yl)-5-(trifluoromethyl)phenyl]methanamine?
[2-(3,5-diethylpyrazol-1-yl)-5-(trifluoromethyl)phenyl]methanamine has a molecular weight of 297.32 g/mol, XLogP of 3.47, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,5-diethylpyrazol-1-yl)-5-(trifluoromethyl)phenyl]methanamine is sourced from PubChem (CID 82696807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).