About 5-bromo-2-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)benzonitrile
5-bromo-2-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)benzonitrile (PubChem CID 82696853) has the molecular formula C17H17BrN2O
and a molecular weight of 345.24 g/mol. Its IUPAC name is 5-bromo-2-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)benzonitrile.
Molecular Properties
| Compound Name | 5-bromo-2-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)benzonitrile |
| PubChem CID | 82696853 |
| Molecular Formula | C17H17BrN2O |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 5-bromo-2-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)benzonitrile |
| SMILES | CC1(C)Cc2c(ccn2-c2ccc(Br)cc2C#N)C(O)C1 |
| InChI | InChI=1S/C17H17BrN2O/c1-17(2)8-15-13(16(21)9-17)5-6-20(15)14-4-3-12(18)7-11(14)10-19/h3-7,16,21H,8-9H2,1-2H3 |
| InChIKey | KRNNTBBHECIJRO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-2-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)benzonitrile?
The IUPAC name of 5-bromo-2-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)benzonitrile (CID 82696853) is 5-bromo-2-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)benzonitrile.
What is the SMILES notation for 5-bromo-2-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)benzonitrile?
The canonical SMILES for 5-bromo-2-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)benzonitrile is CC1(C)Cc2c(ccn2-c2ccc(Br)cc2C#N)C(O)C1.
What is the InChIKey of 5-bromo-2-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)benzonitrile?
The InChIKey is KRNNTBBHECIJRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17BrN2O/c1-17(2)8-15-13(16(21)9-17)5-6-20(15)14-4-3-12(18)7-11(14)10-19/h3-7,16,21H,8-9H2,1-2H3.
What are the key properties of 5-bromo-2-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)benzonitrile?
5-bromo-2-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)benzonitrile has a molecular weight of 345.24 g/mol, XLogP of 4.12, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)benzonitrile is sourced from PubChem (CID 82696853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).