About 1-[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]ethanamine
1-[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]ethanamine (PubChem CID 82696919) has the molecular formula C12H22FN3
and a molecular weight of 227.33 g/mol. Its IUPAC name is 1-[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]ethanamine.
Molecular Properties
| Compound Name | 1-[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]ethanamine |
| PubChem CID | 82696919 |
| Molecular Formula | C12H22FN3 |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.18 |
| IUPAC Name | 1-[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]ethanamine |
| SMILES | CCc1nn(CCCF)c(CC)c1C(C)N |
| InChI | InChI=1S/C12H22FN3/c1-4-10-12(9(3)14)11(5-2)16(15-10)8-6-7-13/h9H,4-8,14H2,1-3H3 |
| InChIKey | LZKCKZMIORYAPE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]ethanamine?
The IUPAC name of 1-[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]ethanamine (CID 82696919) is 1-[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]ethanamine.
What is the SMILES notation for 1-[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]ethanamine?
The canonical SMILES for 1-[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]ethanamine is CCc1nn(CCCF)c(CC)c1C(C)N.
What is the InChIKey of 1-[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]ethanamine?
The InChIKey is LZKCKZMIORYAPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22FN3/c1-4-10-12(9(3)14)11(5-2)16(15-10)8-6-7-13/h9H,4-8,14H2,1-3H3.
What are the key properties of 1-[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]ethanamine?
1-[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]ethanamine has a molecular weight of 227.33 g/mol, XLogP of 2.39, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]ethanamine is sourced from PubChem (CID 82696919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).