About N-[[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]methyl]ethanamine
N-[[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]methyl]ethanamine (PubChem CID 82697029) has the molecular formula C13H24FN3
and a molecular weight of 241.35 g/mol. Its IUPAC name is N-[[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]methyl]ethanamine |
| PubChem CID | 82697029 |
| Molecular Formula | C13H24FN3 |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | N-[[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]methyl]ethanamine |
| SMILES | CCNCc1c(CC)nn(CCCF)c1CC |
| InChI | InChI=1S/C13H24FN3/c1-4-12-11(10-15-6-3)13(5-2)17(16-12)9-7-8-14/h15H,4-10H2,1-3H3 |
| InChIKey | GTESVZASMVHBEZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]methyl]ethanamine?
The IUPAC name of N-[[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]methyl]ethanamine (CID 82697029) is N-[[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]methyl]ethanamine.
What is the SMILES notation for N-[[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]methyl]ethanamine?
The canonical SMILES for N-[[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]methyl]ethanamine is CCNCc1c(CC)nn(CCCF)c1CC.
What is the InChIKey of N-[[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]methyl]ethanamine?
The InChIKey is GTESVZASMVHBEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24FN3/c1-4-12-11(10-15-6-3)13(5-2)17(16-12)9-7-8-14/h15H,4-10H2,1-3H3.
What are the key properties of N-[[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]methyl]ethanamine?
N-[[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]methyl]ethanamine has a molecular weight of 241.35 g/mol, XLogP of 2.48, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3,5-diethyl-1-(3-fluoropropyl)pyrazol-4-yl]methyl]ethanamine is sourced from PubChem (CID 82697029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).