About 6,11-dihydrobenzo[c][1,5]benzothiazepine
6,11-dihydrobenzo[c][1,5]benzothiazepine (PubChem CID 826971) has the molecular formula C13H11NS
and a molecular weight of 213.31 g/mol. Its IUPAC name is 6,11-dihydrobenzo[c][1,5]benzothiazepine.
Molecular Properties
| Compound Name | 6,11-dihydrobenzo[c][1,5]benzothiazepine |
| PubChem CID | 826971 |
| Molecular Formula | C13H11NS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 6,11-dihydrobenzo[c][1,5]benzothiazepine |
| SMILES | c1ccc2c(c1)CSc1ccccc1N2 |
| InChI | InChI=1S/C13H11NS/c1-2-6-11-10(5-1)9-15-13-8-4-3-7-12(13)14-11/h1-8,14H,9H2 |
| InChIKey | JVWKQCOSIPNOKD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,11-dihydrobenzo[c][1,5]benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,11-dihydrobenzo[c][1,5]benzothiazepine?
The IUPAC name of 6,11-dihydrobenzo[c][1,5]benzothiazepine (CID 826971) is 6,11-dihydrobenzo[c][1,5]benzothiazepine.
What is the SMILES notation for 6,11-dihydrobenzo[c][1,5]benzothiazepine?
The canonical SMILES for 6,11-dihydrobenzo[c][1,5]benzothiazepine is c1ccc2c(c1)CSc1ccccc1N2.
What is the InChIKey of 6,11-dihydrobenzo[c][1,5]benzothiazepine?
The InChIKey is JVWKQCOSIPNOKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NS/c1-2-6-11-10(5-1)9-15-13-8-4-3-7-12(13)14-11/h1-8,14H,9H2.
What are the key properties of 6,11-dihydrobenzo[c][1,5]benzothiazepine?
6,11-dihydrobenzo[c][1,5]benzothiazepine has a molecular weight of 213.31 g/mol, XLogP of 4.04, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,11-dihydrobenzo[c][1,5]benzothiazepine is sourced from PubChem (CID 826971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).