C11H15F3N2O — CID 82697995
2,2,2-trifluoro-1-(1,3,5-triethylpyrazol-4-yl)ethanone (PubChem CID 82697995) has the molecular formula C11H15F3N2O and a molecular weight of 248.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(1,3,5-triethylpyrazol-4-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(1,3,5-triethylpyrazol-4-yl)ethanone |
|---|---|
| PubChem CID | 82697995 |
| Molecular Formula | C11H15F3N2O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2,2,2-trifluoro-1-(1,3,5-triethylpyrazol-4-yl)ethanone |
| SMILES | CCc1nn(CC)c(CC)c1C(=O)C(F)(F)F |
| InChI | InChI=1S/C11H15F3N2O/c1-4-7-9(10(17)11(12,13)14)8(5-2)16(6-3)15-7/h4-6H2,1-3H3 |
| InChIKey | HZSLBLMCNPDEIT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |