C9H11F3N2O — CID 82698323
1-(3,5-diethyl-1H-pyrazol-4-yl)-2,2,2-trifluoroethanone (PubChem CID 82698323) has the molecular formula C9H11F3N2O and a molecular weight of 220.19 g/mol. Its IUPAC name is 1-(3,5-diethyl-1H-pyrazol-4-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(3,5-diethyl-1H-pyrazol-4-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 82698323 |
| Molecular Formula | C9H11F3N2O |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-(3,5-diethyl-1H-pyrazol-4-yl)-2,2,2-trifluoroethanone |
| SMILES | CCc1n[nH]c(CC)c1C(=O)C(F)(F)F |
| InChI | InChI=1S/C9H11F3N2O/c1-3-5-7(6(4-2)14-13-5)8(15)9(10,11)12/h3-4H2,1-2H3,(H,13,14) |
| InChIKey | CNNILXIUUPMJJL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |