About 3-[4-[(3,5-diethylpyrazol-1-yl)methyl]-3-fluorophenyl]prop-2-yn-1-ol
3-[4-[(3,5-diethylpyrazol-1-yl)methyl]-3-fluorophenyl]prop-2-yn-1-ol (PubChem CID 82698861) has the molecular formula C17H19FN2O
and a molecular weight of 286.35 g/mol. Its IUPAC name is 3-[4-[(3,5-diethylpyrazol-1-yl)methyl]-3-fluorophenyl]prop-2-yn-1-ol.
Molecular Properties
| Compound Name | 3-[4-[(3,5-diethylpyrazol-1-yl)methyl]-3-fluorophenyl]prop-2-yn-1-ol |
| PubChem CID | 82698861 |
| Molecular Formula | C17H19FN2O |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 3-[4-[(3,5-diethylpyrazol-1-yl)methyl]-3-fluorophenyl]prop-2-yn-1-ol |
| SMILES | CCc1cc(CC)n(Cc2ccc(C#CCO)cc2F)n1 |
| InChI | InChI=1S/C17H19FN2O/c1-3-15-11-16(4-2)20(19-15)12-14-8-7-13(6-5-9-21)10-17(14)18/h7-8,10-11,21H,3-4,9,12H2,1-2H3 |
| InChIKey | GKTVNRQHANGOKW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[(3,5-diethylpyrazol-1-yl)methyl]-3-fluorophenyl]prop-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(3,5-diethylpyrazol-1-yl)methyl]-3-fluorophenyl]prop-2-yn-1-ol?
The IUPAC name of 3-[4-[(3,5-diethylpyrazol-1-yl)methyl]-3-fluorophenyl]prop-2-yn-1-ol (CID 82698861) is 3-[4-[(3,5-diethylpyrazol-1-yl)methyl]-3-fluorophenyl]prop-2-yn-1-ol.
What is the SMILES notation for 3-[4-[(3,5-diethylpyrazol-1-yl)methyl]-3-fluorophenyl]prop-2-yn-1-ol?
The canonical SMILES for 3-[4-[(3,5-diethylpyrazol-1-yl)methyl]-3-fluorophenyl]prop-2-yn-1-ol is CCc1cc(CC)n(Cc2ccc(C#CCO)cc2F)n1.
What is the InChIKey of 3-[4-[(3,5-diethylpyrazol-1-yl)methyl]-3-fluorophenyl]prop-2-yn-1-ol?
The InChIKey is GKTVNRQHANGOKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19FN2O/c1-3-15-11-16(4-2)20(19-15)12-14-8-7-13(6-5-9-21)10-17(14)18/h7-8,10-11,21H,3-4,9,12H2,1-2H3.
What are the key properties of 3-[4-[(3,5-diethylpyrazol-1-yl)methyl]-3-fluorophenyl]prop-2-yn-1-ol?
3-[4-[(3,5-diethylpyrazol-1-yl)methyl]-3-fluorophenyl]prop-2-yn-1-ol has a molecular weight of 286.35 g/mol, XLogP of 2.54, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(3,5-diethylpyrazol-1-yl)methyl]-3-fluorophenyl]prop-2-yn-1-ol is sourced from PubChem (CID 82698861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).