About 4-(1-chloroethyl)-3,5-diethyl-1-(2-fluoroethyl)pyrazole
4-(1-chloroethyl)-3,5-diethyl-1-(2-fluoroethyl)pyrazole (PubChem CID 82698898) has the molecular formula C11H18ClFN2
and a molecular weight of 232.73 g/mol. Its IUPAC name is 4-(1-chloroethyl)-3,5-diethyl-1-(2-fluoroethyl)pyrazole.
Molecular Properties
| Compound Name | 4-(1-chloroethyl)-3,5-diethyl-1-(2-fluoroethyl)pyrazole |
| PubChem CID | 82698898 |
| Molecular Formula | C11H18ClFN2 |
| Molecular Weight | 232.73 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 4-(1-chloroethyl)-3,5-diethyl-1-(2-fluoroethyl)pyrazole |
| SMILES | CCc1nn(CCF)c(CC)c1C(C)Cl |
| InChI | InChI=1S/C11H18ClFN2/c1-4-9-11(8(3)12)10(5-2)15(14-9)7-6-13/h8H,4-7H2,1-3H3 |
| InChIKey | HEKRDMROOPHWGD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.73 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-chloroethyl)-3,5-diethyl-1-(2-fluoroethyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-chloroethyl)-3,5-diethyl-1-(2-fluoroethyl)pyrazole?
The IUPAC name of 4-(1-chloroethyl)-3,5-diethyl-1-(2-fluoroethyl)pyrazole (CID 82698898) is 4-(1-chloroethyl)-3,5-diethyl-1-(2-fluoroethyl)pyrazole.
What is the SMILES notation for 4-(1-chloroethyl)-3,5-diethyl-1-(2-fluoroethyl)pyrazole?
The canonical SMILES for 4-(1-chloroethyl)-3,5-diethyl-1-(2-fluoroethyl)pyrazole is CCc1nn(CCF)c(CC)c1C(C)Cl.
What is the InChIKey of 4-(1-chloroethyl)-3,5-diethyl-1-(2-fluoroethyl)pyrazole?
The InChIKey is HEKRDMROOPHWGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18ClFN2/c1-4-9-11(8(3)12)10(5-2)15(14-9)7-6-13/h8H,4-7H2,1-3H3.
What are the key properties of 4-(1-chloroethyl)-3,5-diethyl-1-(2-fluoroethyl)pyrazole?
4-(1-chloroethyl)-3,5-diethyl-1-(2-fluoroethyl)pyrazole has a molecular weight of 232.73 g/mol, XLogP of 3.28, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-chloroethyl)-3,5-diethyl-1-(2-fluoroethyl)pyrazole is sourced from PubChem (CID 82698898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).