About 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3,5-diethylpyrazole
1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3,5-diethylpyrazole (PubChem CID 82699233) has the molecular formula C17H22N2O
and a molecular weight of 270.38 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3,5-diethylpyrazole.
Molecular Properties
| Compound Name | 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3,5-diethylpyrazole |
| PubChem CID | 82699233 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3,5-diethylpyrazole |
| SMILES | CCc1cc(CC)n(CC2OCCc3ccccc32)n1 |
| InChI | InChI=1S/C17H22N2O/c1-3-14-11-15(4-2)19(18-14)12-17-16-8-6-5-7-13(16)9-10-20-17/h5-8,11,17H,3-4,9-10,12H2,1-2H3 |
| InChIKey | ANNPMXGHTXKYMR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3,5-diethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3,5-diethylpyrazole?
The IUPAC name of 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3,5-diethylpyrazole (CID 82699233) is 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3,5-diethylpyrazole.
What is the SMILES notation for 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3,5-diethylpyrazole?
The canonical SMILES for 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3,5-diethylpyrazole is CCc1cc(CC)n(CC2OCCc3ccccc32)n1.
What is the InChIKey of 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3,5-diethylpyrazole?
The InChIKey is ANNPMXGHTXKYMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O/c1-3-14-11-15(4-2)19(18-14)12-17-16-8-6-5-7-13(16)9-10-20-17/h5-8,11,17H,3-4,9-10,12H2,1-2H3.
What are the key properties of 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3,5-diethylpyrazole?
1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3,5-diethylpyrazole has a molecular weight of 270.38 g/mol, XLogP of 3.32, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3,5-diethylpyrazole is sourced from PubChem (CID 82699233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).