C13H19N5 — CID 82699423
4-(3,5-diethylpyrazol-1-yl)-N,5-dimethylpyrimidin-2-amine (PubChem CID 82699423) has the molecular formula C13H19N5 and a molecular weight of 245.33 g/mol. Its IUPAC name is 4-(3,5-diethylpyrazol-1-yl)-N,5-dimethylpyrimidin-2-amine.
| Compound Name | 4-(3,5-diethylpyrazol-1-yl)-N,5-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 82699423 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 4-(3,5-diethylpyrazol-1-yl)-N,5-dimethylpyrimidin-2-amine |
| SMILES | CCc1cc(CC)n(-c2nc(NC)ncc2C)n1 |
| InChI | InChI=1S/C13H19N5/c1-5-10-7-11(6-2)18(17-10)12-9(3)8-15-13(14-4)16-12/h7-8H,5-6H2,1-4H3,(H,14,15,16) |
| InChIKey | PUXNNIUYNMIDFN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |